C20H21BrN4O3S — CID 41345232
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide (PubChem CID 41345232) has the molecular formula C20H21BrN4O3S and a molecular weight of 477.38 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41345232 |
| Molecular Formula | C20H21BrN4O3S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc([N+](=O)[O-])cc1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C20H21BrN4O3S/c1-3-23(4-2)11-12-24(19(26)14-5-8-16(9-6-14)25(27)28)20-22-17-10-7-15(21)13-18(17)29-20/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | KNHMPMYTICUPSI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|