C22H21BrN4O3S2 — CID 43959508
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 43959508) has the molecular formula C22H21BrN4O3S2 and a molecular weight of 533.47 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43959508 |
| Molecular Formula | C22H21BrN4O3S2 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc2cc([N+](=O)[O-])ccc2s1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C22H21BrN4O3S2/c1-3-25(4-2)9-10-26(22-24-17-7-5-15(23)13-19(17)32-22)21(28)20-12-14-11-16(27(29)30)6-8-18(14)31-20/h5-8,11-13H,3-4,9-10H2,1-2H3 |
| InChIKey | JRHUTIQTFVMNCQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|