C24H27ClN4O3S2 — CID 44927005
N-[2-(diethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 44927005) has the molecular formula C24H27ClN4O3S2 and a molecular weight of 519.09 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44927005 |
| Molecular Formula | C24H27ClN4O3S2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1cc2cc([N+](=O)[O-])ccc2s1)c1nc2cc(C)cc(C)c2s1.Cl |
| InChI | InChI=1S/C24H26N4O3S2.ClH/c1-5-26(6-2)9-10-27(24-25-19-12-15(3)11-16(4)22(19)33-24)23(29)21-14-17-13-18(28(30)31)7-8-20(17)32-21;/h7-8,11-14H,5-6,9-10H2,1-4H3;1H |
| InChIKey | SBEDTGHSVYLACJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|