C20H21ClN4O3S — CID 41344539
2-chloro-N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide (PubChem CID 41344539) has the molecular formula C20H21ClN4O3S and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 41344539 |
| Molecular Formula | C20H21ClN4O3S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
| SMILES | Cc1cc(C)c2sc(N(CCN(C)C)C(=O)c3cc([N+](=O)[O-])ccc3Cl)nc2c1 |
| InChI | InChI=1S/C20H21ClN4O3S/c1-12-9-13(2)18-17(10-12)22-20(29-18)24(8-7-23(3)4)19(26)15-11-14(25(27)28)5-6-16(15)21/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | TZMZVCQNLUJKGQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|