C20H22Cl2N4O3S — CID 44929629
2-chloro-N-[3-(dimethylamino)propyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide;hydrochloride (PubChem CID 44929629) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)propyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide;hydrochloride.
| Compound Name | 2-chloro-N-[3-(dimethylamino)propyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44929629 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)propyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide;hydrochloride |
| SMILES | Cc1ccc2nc(N(CCCN(C)C)C(=O)c3cc([N+](=O)[O-])ccc3Cl)sc2c1.Cl |
| InChI | InChI=1S/C20H21ClN4O3S.ClH/c1-13-5-8-17-18(11-13)29-20(22-17)24(10-4-9-23(2)3)19(26)15-12-14(25(27)28)6-7-16(15)21;/h5-8,11-12H,4,9-10H2,1-3H3;1H |
| InChIKey | BRDDMYFBEVDKDM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|