C20H21Cl3N4O3S — CID 44925513
2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitrobenzamide;hydrochloride (PubChem CID 44925513) has the molecular formula C20H21Cl3N4O3S and a molecular weight of 503.84 g/mol. Its IUPAC name is 2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitrobenzamide;hydrochloride.
| Compound Name | 2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44925513 |
| Molecular Formula | C20H21Cl3N4O3S |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-chloro-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-5-nitrobenzamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1cc([N+](=O)[O-])ccc1Cl)c1nc2ccc(Cl)cc2s1.Cl |
| InChI | InChI=1S/C20H20Cl2N4O3S.ClH/c1-3-24(4-2)9-10-25(20-23-17-8-5-13(21)11-18(17)30-20)19(27)15-12-14(26(28)29)6-7-16(15)22;/h5-8,11-12H,3-4,9-10H2,1-2H3;1H |
| InChIKey | LHKOGAIELKFVAF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|