C21H21ClN4O5S — CID 41345852
2-chloro-N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5-nitrobenzamide (PubChem CID 41345852) has the molecular formula C21H21ClN4O5S and a molecular weight of 476.94 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 41345852 |
| Molecular Formula | C21H21ClN4O5S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc([N+](=O)[O-])ccc1Cl)c1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C21H21ClN4O5S/c1-3-24(4-2)7-8-25(20(27)14-9-13(26(28)29)5-6-15(14)22)21-23-16-10-17-18(31-12-30-17)11-19(16)32-21/h5-6,9-11H,3-4,7-8,12H2,1-2H3 |
| InChIKey | LOUSIYOCYRZILZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|