C23H24N4O5S — CID 74757595
N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 74757595) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74757595 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)C=Cc1ccc([N+](=O)[O-])cc1)c1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C23H24N4O5S/c1-3-25(4-2)11-12-26(22(28)10-7-16-5-8-17(9-6-16)27(29)30)23-24-18-13-19-20(32-15-31-19)14-21(18)33-23/h5-10,13-14H,3-4,11-12,15H2,1-2H3 |
| InChIKey | NDPMZPFQXVGHLN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|