C23H26N4O5S2 — CID 74769053
N-[2-(diethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 74769053) has the molecular formula C23H26N4O5S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74769053 |
| Molecular Formula | C23H26N4O5S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)C=Cc1ccc([N+](=O)[O-])cc1)c1nc2c(S(C)(=O)=O)cccc2s1 |
| InChI | InChI=1S/C23H26N4O5S2/c1-4-25(5-2)15-16-26(21(28)14-11-17-9-12-18(13-10-17)27(29)30)23-24-22-19(33-23)7-6-8-20(22)34(3,31)32/h6-14H,4-5,15-16H2,1-3H3 |
| InChIKey | JBXSDAKGVJGEKP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|