C21H22ClN3O3S2 — CID 74769045
3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 74769045) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 74769045 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CN(C)CCN(C(=O)C=Cc1ccccc1Cl)c1nc2c(S(C)(=O)=O)cccc2s1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c1-24(2)13-14-25(19(26)12-11-15-7-4-5-8-16(15)22)21-23-20-17(29-21)9-6-10-18(20)30(3,27)28/h4-12H,13-14H2,1-3H3 |
| InChIKey | POPGJVIWNRSQPN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|