C21H22ClN5O7S — CID 44926410
N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride (PubChem CID 44926410) has the molecular formula C21H22ClN5O7S and a molecular weight of 523.96 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44926410 |
| Molecular Formula | C21H22ClN5O7S |
| Molecular Weight | 523.96 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2cc3c(cc2s1)OCO3.Cl |
| InChI | InChI=1S/C21H21N5O7S.ClH/c1-3-23(4-2)5-6-24(20(27)13-7-14(25(28)29)9-15(8-13)26(30)31)21-22-16-10-17-18(33-12-32-17)11-19(16)34-21;/h7-11H,3-6,12H2,1-2H3;1H |
| InChIKey | GZDVFGVSUZDOLG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|