C22H25N5O7S — CID 41346103
N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 41346103) has the molecular formula C22H25N5O7S and a molecular weight of 503.54 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41346103 |
| Molecular Formula | C22H25N5O7S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2cc(OC)c(OC)cc2s1 |
| InChI | InChI=1S/C22H25N5O7S/c1-5-24(6-2)7-8-25(21(28)14-9-15(26(29)30)11-16(10-14)27(31)32)22-23-17-12-18(33-3)19(34-4)13-20(17)35-22/h9-13H,5-8H2,1-4H3 |
| InChIKey | CVNAHEPYKZEPSB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|