C26H35N3O4S — CID 41346031
4-butoxy-N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41346031) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is 4-butoxy-N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-butoxy-N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41346031 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 4-butoxy-N-[2-(diethylamino)ethyl]-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCN(CC)CC)c2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C26H35N3O4S/c1-6-9-16-33-20-12-10-19(11-13-20)25(30)29(15-14-28(7-2)8-3)26-27-21-17-22(31-4)23(32-5)18-24(21)34-26/h10-13,17-18H,6-9,14-16H2,1-5H3 |
| InChIKey | DAAMLJCMJUKKKB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|