C25H32ClN3O2S — CID 43959445
N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-pentoxybenzamide (PubChem CID 43959445) has the molecular formula C25H32ClN3O2S and a molecular weight of 474.07 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-pentoxybenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 43959445 |
| Molecular Formula | C25H32ClN3O2S |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(CCN(CC)CC)c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C25H32ClN3O2S/c1-4-7-8-17-31-21-12-9-19(10-13-21)24(30)29(16-15-28(5-2)6-3)25-27-22-14-11-20(26)18-23(22)32-25/h9-14,18H,4-8,15-17H2,1-3H3 |
| InChIKey | MGKZLRKZXARWKR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|