C24H30ClN3O2S — CID 43959419
4-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 43959419) has the molecular formula C24H30ClN3O2S and a molecular weight of 460.04 g/mol. Its IUPAC name is 4-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 43959419 |
| Molecular Formula | C24H30ClN3O2S |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCN(CC)CC)c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C24H30ClN3O2S/c1-4-7-16-30-20-11-8-18(9-12-20)23(29)28(15-14-27(5-2)6-3)24-26-21-13-10-19(25)17-22(21)31-24/h8-13,17H,4-7,14-16H2,1-3H3 |
| InChIKey | NWHVZLRCSHAOEV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|