C27H37N3O3S — CID 43959334
N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-pentoxybenzamide (PubChem CID 43959334) has the molecular formula C27H37N3O3S and a molecular weight of 483.68 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-pentoxybenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43959334 |
| Molecular Formula | C27H37N3O3S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCN(CC)CC)c2nc3ccc(OCC)cc3s2)c1 |
| InChI | InChI=1S/C27H37N3O3S/c1-5-9-10-18-33-22-13-11-12-21(19-22)26(31)30(17-16-29(6-2)7-3)27-28-24-15-14-23(32-8-4)20-25(24)34-27/h11-15,19-20H,5-10,16-18H2,1-4H3 |
| InChIKey | REHMQYLYZASADX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|