C26H36ClN3O3S — CID 44925212
4-butoxy-N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide;hydrochloride (PubChem CID 44925212) has the molecular formula C26H36ClN3O3S and a molecular weight of 506.11 g/mol. Its IUPAC name is 4-butoxy-N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide;hydrochloride.
| Compound Name | 4-butoxy-N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 44925212 |
| Molecular Formula | C26H36ClN3O3S |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-butoxy-N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)N(CCN(CC)CC)c2nc3ccc(OCC)cc3s2)cc1.Cl |
| InChI | InChI=1S/C26H35N3O3S.ClH/c1-5-9-18-32-21-12-10-20(11-13-21)25(30)29(17-16-28(6-2)7-3)26-27-23-15-14-22(31-8-4)19-24(23)33-26;/h10-15,19H,5-9,16-18H2,1-4H3;1H |
| InChIKey | YIQIXTIYKJFONC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|