C25H34ClN3O2S — CID 44925036
3-butoxy-N-[2-(diethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide;hydrochloride (PubChem CID 44925036) has the molecular formula C25H34ClN3O2S and a molecular weight of 476.09 g/mol. Its IUPAC name is 3-butoxy-N-[2-(diethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide;hydrochloride.
| Compound Name | 3-butoxy-N-[2-(diethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 44925036 |
| Molecular Formula | C25H34ClN3O2S |
| Molecular Weight | 476.09 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-butoxy-N-[2-(diethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide;hydrochloride |
| SMILES | CCCCOc1cccc(C(=O)N(CCN(CC)CC)c2nc3ccc(C)cc3s2)c1.Cl |
| InChI | InChI=1S/C25H33N3O2S.ClH/c1-5-8-16-30-21-11-9-10-20(18-21)24(29)28(15-14-27(6-2)7-3)25-26-22-13-12-19(4)17-23(22)31-25;/h9-13,17-18H,5-8,14-16H2,1-4H3;1H |
| InChIKey | KFMOKHPOHYZFTJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|