C26H35N3O2S — CID 43960187
3-butoxy-N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43960187) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is 3-butoxy-N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43960187 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-butoxy-N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCN(CC)CC)c2nc3c(C)cc(C)cc3s2)c1 |
| InChI | InChI=1S/C26H35N3O2S/c1-6-9-15-31-22-12-10-11-21(18-22)25(30)29(14-13-28(7-2)8-3)26-27-24-20(5)16-19(4)17-23(24)32-26/h10-12,16-18H,6-9,13-15H2,1-5H3 |
| InChIKey | KWWXXKJSSRFAFN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|