C27H37N3O2S — CID 43960188
N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-pentoxybenzamide (PubChem CID 43960188) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-pentoxybenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43960188 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCN(CC)CC)c2nc3c(C)cc(C)cc3s2)c1 |
| InChI | InChI=1S/C27H37N3O2S/c1-6-9-10-16-32-23-13-11-12-22(19-23)26(31)30(15-14-29(7-2)8-3)27-28-25-21(5)17-20(4)18-24(25)33-27/h11-13,17-19H,6-10,14-16H2,1-5H3 |
| InChIKey | IZRWPPRVCYGOKE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|