C26H32ClN3O3S — CID 43963235
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide (PubChem CID 43963235) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43963235 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCN2CCOCC2)c2nc3c(C)cc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C26H32ClN3O3S/c1-3-4-5-13-33-22-8-6-7-20(17-22)25(31)30(10-9-29-11-14-32-15-12-29)26-28-24-19(2)16-21(27)18-23(24)34-26/h6-8,16-18H,3-5,9-15H2,1-2H3 |
| InChIKey | CHMILFLVVJTXHC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|