C27H35N3O4S — CID 29138548
N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide (PubChem CID 29138548) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide.
| Compound Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 29138548 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCN2CCOCC2)c2nc3c(OC)ccc(C)c3s2)c1 |
| InChI | InChI=1S/C27H35N3O4S/c1-4-5-6-16-34-22-9-7-8-21(19-22)26(31)30(13-12-29-14-17-33-18-15-29)27-28-24-23(32-3)11-10-20(2)25(24)35-27/h7-11,19H,4-6,12-18H2,1-3H3 |
| InChIKey | KVGIKYYYPSWDKZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|