C24H31N3O2S — CID 43958687
3-butoxy-N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43958687) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 3-butoxy-N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43958687 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-butoxy-N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCN(C)C)c2nc3ccc(CC)cc3s2)c1 |
| InChI | InChI=1S/C24H31N3O2S/c1-5-7-15-29-20-10-8-9-19(17-20)23(28)27(14-13-26(3)4)24-25-21-12-11-18(6-2)16-22(21)30-24/h8-12,16-17H,5-7,13-15H2,1-4H3 |
| InChIKey | NVVOPAVNGOWJOX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|