C24H30FN3O2S — CID 43963591
N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-pentoxybenzamide (PubChem CID 43963591) has the molecular formula C24H30FN3O2S and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-pentoxybenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 43963591 |
| Molecular Formula | C24H30FN3O2S |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCCN(C)C)c2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C24H30FN3O2S/c1-4-5-6-15-30-20-10-7-9-18(16-20)23(29)28(14-8-13-27(2)3)24-26-21-12-11-19(25)17-22(21)31-24/h7,9-12,16-17H,4-6,8,13-15H2,1-3H3 |
| InChIKey | FRNKYPIPIVKVAA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|