C25H31N3O4S — CID 41344130
N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-pentoxybenzamide (PubChem CID 41344130) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-pentoxybenzamide.
| Compound Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-pentoxybenzamide |
|---|---|
| PubChem CID | 41344130 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)N(CCN(C)C)c2nc3cc4c(cc3s2)OCCO4)c1 |
| InChI | InChI=1S/C25H31N3O4S/c1-4-5-6-12-30-19-9-7-8-18(15-19)24(29)28(11-10-27(2)3)25-26-20-16-21-22(17-23(20)33-25)32-14-13-31-21/h7-9,15-17H,4-6,10-14H2,1-3H3 |
| InChIKey | SIGKWHRYBIIIPR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|