C23H28ClN3O4S — CID 44924072
3-butoxy-N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)benzamide;hydrochloride (PubChem CID 44924072) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 3-butoxy-N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)benzamide;hydrochloride.
| Compound Name | 3-butoxy-N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 44924072 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 3-butoxy-N-[2-(dimethylamino)ethyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)benzamide;hydrochloride |
| SMILES | CCCCOc1cccc(C(=O)N(CCN(C)C)c2nc3cc4c(cc3s2)OCO4)c1.Cl |
| InChI | InChI=1S/C23H27N3O4S.ClH/c1-4-5-11-28-17-8-6-7-16(12-17)22(27)26(10-9-25(2)3)23-24-18-13-19-20(30-15-29-19)14-21(18)31-23;/h6-8,12-14H,4-5,9-11,15H2,1-3H3;1H |
| InChIKey | GZCSYMNEEKQFEQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|