C23H28ClN3O2S — CID 43963629
3-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 43963629) has the molecular formula C23H28ClN3O2S and a molecular weight of 446.02 g/mol. Its IUPAC name is 3-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 43963629 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-butoxy-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCCN(C)C)c2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C23H28ClN3O2S/c1-4-5-14-29-19-9-6-8-17(15-19)22(28)27(13-7-12-26(2)3)23-25-20-11-10-18(24)16-21(20)30-23/h6,8-11,15-16H,4-5,7,12-14H2,1-3H3 |
| InChIKey | VWFLYRRDUOJEEH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|