C24H31N3O2S — CID 16896513
N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide (PubChem CID 16896513) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 16896513 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(6-methyl-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(CCN(C)C)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C24H31N3O2S/c1-5-6-7-16-29-20-11-9-19(10-12-20)23(28)27(15-14-26(3)4)24-25-21-13-8-18(2)17-22(21)30-24/h8-13,17H,5-7,14-16H2,1-4H3 |
| InChIKey | XQANAXUADWZKSU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|