C21H22N2O3S — CID 39910810
[4-[butyl-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 39910810) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is [4-[butyl-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[butyl-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 39910810 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [4-[butyl-(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CCCCN(C(=O)c1ccc(OC(C)=O)cc1)c1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C21H22N2O3S/c1-4-5-12-23(21-22-18-11-6-14(2)13-19(18)27-21)20(25)16-7-9-17(10-8-16)26-15(3)24/h6-11,13H,4-5,12H2,1-3H3 |
| InChIKey | NPVDUEQJNNIRGF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|