C25H33N3O4S — CID 41344229
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-pentoxybenzamide (PubChem CID 41344229) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-pentoxybenzamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 41344229 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(CCN(C)C)c2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C25H33N3O4S/c1-6-7-8-15-32-19-11-9-18(10-12-19)24(29)28(14-13-27(2)3)25-26-20-16-21(30-4)22(31-5)17-23(20)33-25/h9-12,16-17H,6-8,13-15H2,1-5H3 |
| InChIKey | QAVITCBEVBFXBX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|