C22H27BrClN3O2S — CID 44923336
N-(6-bromo-1,3-benzothiazol-2-yl)-4-butoxy-N-[2-(dimethylamino)ethyl]benzamide;hydrochloride (PubChem CID 44923336) has the molecular formula C22H27BrClN3O2S and a molecular weight of 512.90 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-butoxy-N-[2-(dimethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-butoxy-N-[2-(dimethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44923336 |
| Molecular Formula | C22H27BrClN3O2S |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-butoxy-N-[2-(dimethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)N(CCN(C)C)c2nc3ccc(Br)cc3s2)cc1.Cl |
| InChI | InChI=1S/C22H26BrN3O2S.ClH/c1-4-5-14-28-18-9-6-16(7-10-18)21(27)26(13-12-25(2)3)22-24-19-11-8-17(23)15-20(19)29-22;/h6-11,15H,4-5,12-14H2,1-3H3;1H |
| InChIKey | TYUBTPAHZFVNOC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.90 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|