C22H25N5O6S — CID 41346553
N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 41346553) has the molecular formula C22H25N5O6S and a molecular weight of 487.54 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41346553 |
| Molecular Formula | C22H25N5O6S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2c(OC)ccc(C)c2s1 |
| InChI | InChI=1S/C22H25N5O6S/c1-5-24(6-2)9-10-25(22-23-19-18(33-4)8-7-14(3)20(19)34-22)21(28)15-11-16(26(29)30)13-17(12-15)27(31)32/h7-8,11-13H,5-6,9-10H2,1-4H3 |
| InChIKey | FTLPUSOKDNSTSC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 131.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|