C24H28N4O4S — CID 74757627
N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 74757627) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74757627 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)C=Cc1cccc([N+](=O)[O-])c1)c1nc2c(OC)ccc(C)c2s1 |
| InChI | InChI=1S/C24H28N4O4S/c1-5-26(6-2)14-15-27(21(29)13-11-18-8-7-9-19(16-18)28(30)31)24-25-22-20(32-4)12-10-17(3)23(22)33-24/h7-13,16H,5-6,14-15H2,1-4H3 |
| InChIKey | LZNYCQDLTNLOHM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|