C24H24ClN5O5S — CID 44909666
(E)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide;hydrochloride (PubChem CID 44909666) has the molecular formula C24H24ClN5O5S and a molecular weight of 530.01 g/mol. Its IUPAC name is (E)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 44909666 |
| Molecular Formula | C24H24ClN5O5S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (E)-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(3-imidazol-1-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide;hydrochloride |
| SMILES | COc1ccc(OC)c2sc(N(CCCn3ccnc3)C(=O)/C=C/c3cccc([N+](=O)[O-])c3)nc12.Cl |
| InChI | InChI=1S/C24H23N5O5S.ClH/c1-33-19-8-9-20(34-2)23-22(19)26-24(35-23)28(13-4-12-27-14-11-25-16-27)21(30)10-7-17-5-3-6-18(15-17)29(31)32;/h3,5-11,14-16H,4,12-13H2,1-2H3;1H/b10-7+; |
| InChIKey | FEPDWQPXGLTOAJ-HCUGZAAXSA-N |
| XLogP | 4.98 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|