C23H22ClN5O4S — CID 44909230
(E)-N-(3-imidazol-1-ylpropyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide;hydrochloride (PubChem CID 44909230) has the molecular formula C23H22ClN5O4S and a molecular weight of 499.98 g/mol. Its IUPAC name is (E)-N-(3-imidazol-1-ylpropyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-(3-imidazol-1-ylpropyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 44909230 |
| Molecular Formula | C23H22ClN5O4S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (E)-N-(3-imidazol-1-ylpropyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4-nitrophenyl)prop-2-enamide;hydrochloride |
| SMILES | COc1ccc2nc(N(CCCn3ccnc3)C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)sc2c1.Cl |
| InChI | InChI=1S/C23H21N5O4S.ClH/c1-32-19-8-9-20-21(15-19)33-23(25-20)27(13-2-12-26-14-11-24-16-26)22(29)10-5-17-3-6-18(7-4-17)28(30)31;/h3-11,14-16H,2,12-13H2,1H3;1H/b10-5+; |
| InChIKey | YOVSDZPYVDIHIA-OAZHBLANSA-N |
| XLogP | 4.97 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|