C20H20ClN5O7S — CID 44930653
N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride (PubChem CID 44930653) has the molecular formula C20H20ClN5O7S and a molecular weight of 509.93 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride.
| Compound Name | N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44930653 |
| Molecular Formula | C20H20ClN5O7S |
| Molecular Weight | 509.93 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-3,5-dinitrobenzamide;hydrochloride |
| SMILES | CN(C)CCCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2cc3c(cc2s1)OCO3.Cl |
| InChI | InChI=1S/C20H19N5O7S.ClH/c1-22(2)4-3-5-23(19(26)12-6-13(24(27)28)8-14(7-12)25(29)30)20-21-15-9-16-17(32-11-31-16)10-18(15)33-20;/h6-10H,3-5,11H2,1-2H3;1H |
| InChIKey | CFVSFMXCGKOENI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 141.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|