C24H27ClN3O3S- — CID 53352868
N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide chloride (PubChem CID 53352868) has the molecular formula C24H27ClN3O3S- and a molecular weight of 473.02 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide chloride.
| Compound Name | N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide chloride |
|---|---|
| PubChem CID | 53352868 |
| Molecular Formula | C24H27ClN3O3S- |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide chloride |
| SMILES | CN(C)CCCN(C(=O)c1ccc2c(c1)CCCC2)c1nc2cc3c(cc2s1)OCO3.[Cl-] |
| InChI | InChI=1S/C24H27N3O3S.ClH/c1-26(2)10-5-11-27(23(28)18-9-8-16-6-3-4-7-17(16)12-18)24-25-19-13-20-21(30-15-29-20)14-22(19)31-24;/h8-9,12-14H,3-7,10-11,15H2,1-2H3;1H/p-1 |
| InChIKey | QBELLQANYUDETG-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |