C26H31N3O3S — CID 41345955
N-[2-(diethylamino)ethyl]-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 41345955) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 41345955 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc2c(c1)CCCC2)c1nc2cc3c(cc2s1)OCCO3 |
| InChI | InChI=1S/C26H31N3O3S/c1-3-28(4-2)11-12-29(25(30)20-10-9-18-7-5-6-8-19(18)15-20)26-27-21-16-22-23(17-24(21)33-26)32-14-13-31-22/h9-10,15-17H,3-8,11-14H2,1-2H3 |
| InChIKey | GTZIGNIVKKOGHL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |