C21H23ClN4O5S2 — CID 41045480
2-(4-chlorophenyl)sulfonyl-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41045480) has the molecular formula C21H23ClN4O5S2 and a molecular weight of 511.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41045480 |
| Molecular Formula | C21H23ClN4O5S2 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCN(CC)CCN(C(=O)CS(=O)(=O)c1ccc(Cl)cc1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C21H23ClN4O5S2/c1-3-24(4-2)11-12-25(20(27)14-33(30,31)17-8-5-15(22)6-9-17)21-23-18-10-7-16(26(28)29)13-19(18)32-21/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | FCOZPRPQKZCORH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|