C21H25ClN4O5S2 — CID 44928108
2-(benzenesulfonyl)-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide;hydrochloride (PubChem CID 44928108) has the molecular formula C21H25ClN4O5S2 and a molecular weight of 513.04 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(benzenesulfonyl)-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 44928108 |
| Molecular Formula | C21H25ClN4O5S2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 2-(benzenesulfonyl)-N-[2-(diethylamino)ethyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)CS(=O)(=O)c1ccccc1)c1nc2ccc([N+](=O)[O-])cc2s1.Cl |
| InChI | InChI=1S/C21H24N4O5S2.ClH/c1-3-23(4-2)12-13-24(20(26)15-32(29,30)17-8-6-5-7-9-17)21-22-18-11-10-16(25(27)28)14-19(18)31-21;/h5-11,14H,3-4,12-13,15H2,1-2H3;1H |
| InChIKey | IELZJVPNHUFYEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|