C21H15FN4O5S2 — CID 41047291
2-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 41047291) has the molecular formula C21H15FN4O5S2 and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 41047291 |
| Molecular Formula | C21H15FN4O5S2 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(F)cc1)N(Cc1ccccn1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C21H15FN4O5S2/c22-14-4-7-17(8-5-14)33(30,31)13-20(27)25(12-15-3-1-2-10-23-15)21-24-18-9-6-16(26(28)29)11-19(18)32-21/h1-11H,12-13H2 |
| InChIKey | KUEYHKRAONGFRS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 123.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|