C19H15N7O3S — CID 43987637
N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-3-carboxamide (PubChem CID 43987637) has the molecular formula C19H15N7O3S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-3-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-3-carboxamide |
|---|---|
| PubChem CID | 43987637 |
| Molecular Formula | C19H15N7O3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole-3-carboxamide |
| SMILES | O=C(c1nnc2n1CCC2)N(Cc1ccccn1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C19H15N7O3S/c27-18(17-23-22-16-5-3-9-24(16)17)25(11-12-4-1-2-8-20-12)19-21-14-7-6-13(26(28)29)10-15(14)30-19/h1-2,4,6-8,10H,3,5,9,11H2 |
| InChIKey | PSMDUMHLNNMVHR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|