C19H16N6O4S — CID 43987628
3-methoxy-1-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 43987628) has the molecular formula C19H16N6O4S and a molecular weight of 424.44 g/mol. Its IUPAC name is 3-methoxy-1-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43987628 |
| Molecular Formula | C19H16N6O4S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-methoxy-1-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)N(Cc1ccccn1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C19H16N6O4S/c1-23-11-14(17(22-23)29-2)18(26)24(10-12-5-3-4-8-20-12)19-21-15-7-6-13(25(27)28)9-16(15)30-19/h3-9,11H,10H2,1-2H3 |
| InChIKey | QYUJORCOSUNRMJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|