C20H21N5O5S — CID 41344541
N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 41344541) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41344541 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | Cc1cc(C)c2sc(N(CCN(C)C)C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C20H21N5O5S/c1-12-7-13(2)18-17(8-12)21-20(31-18)23(6-5-22(3)4)19(26)14-9-15(24(27)28)11-16(10-14)25(29)30/h7-11H,5-6H2,1-4H3 |
| InChIKey | JQAVGAQAFJDOMY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|