C24H26N4O5S2 — CID 43960353
N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 43960353) has the molecular formula C24H26N4O5S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43960353 |
| Molecular Formula | C24H26N4O5S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc2cc([N+](=O)[O-])ccc2s1)c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C24H26N4O5S2/c1-5-26(6-2)11-12-27(24-25-21-17(32-3)8-9-18(33-4)22(21)35-24)23(29)20-14-15-13-16(28(30)31)7-10-19(15)34-20/h7-10,13-14H,5-6,11-12H2,1-4H3 |
| InChIKey | YHAFSRBLNLQTIG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|