C21H19ClN4O4S2 — CID 41076070
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 41076070) has the molecular formula C21H19ClN4O4S2 and a molecular weight of 490.99 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41076070 |
| Molecular Formula | C21H19ClN4O4S2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(N(CCN(C)C)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)nc12 |
| InChI | InChI=1S/C21H19ClN4O4S2/c1-24(2)8-9-25(21-23-18-15(30-3)6-5-14(22)19(18)32-21)20(27)17-11-12-10-13(26(28)29)4-7-16(12)31-17/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | GTOKUTIHFXRJOB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|