C17H17ClN4O5S — CID 18580647
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 18580647) has the molecular formula C17H17ClN4O5S and a molecular weight of 424.87 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 18580647 |
| Molecular Formula | C17H17ClN4O5S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(N(CCN(C)C)C(=O)c3ccc([N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C17H17ClN4O5S/c1-20(2)8-9-21(16(23)12-6-7-13(27-12)22(24)25)17-19-14-11(26-3)5-4-10(18)15(14)28-17/h4-7H,8-9H2,1-3H3 |
| InChIKey | NRRBHQZESYPGPI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|