C18H20N4O6S — CID 41344663
N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 41344663) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 41344663 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(OC)c2sc(N(CCN(C)C)C(=O)c3ccc([N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C18H20N4O6S/c1-20(2)9-10-21(17(23)13-7-8-14(28-13)22(24)25)18-19-15-11(26-3)5-6-12(27-4)16(15)29-18/h5-8H,9-10H2,1-4H3 |
| InChIKey | HCGJSSQFPAPLED-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 111.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|