C24H29N5O6S — CID 43962351
N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43962351) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43962351 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | COc1ccc(OC)c2sc(N(CCN(C)C)C(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C24H29N5O6S/c1-26(2)9-10-28(24-25-21-19(33-3)7-8-20(34-4)22(21)36-24)23(30)16-5-6-17(18(15-16)29(31)32)27-11-13-35-14-12-27/h5-8,15H,9-14H2,1-4H3 |
| InChIKey | IITIGFGSNWRCIC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|