C24H27F2N5O4S — CID 43962216
N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43962216) has the molecular formula C24H27F2N5O4S and a molecular weight of 519.57 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43962216 |
| Molecular Formula | C24H27F2N5O4S |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C24H27F2N5O4S/c1-3-28(4-2)7-8-30(24-27-22-18(26)14-17(25)15-21(22)36-24)23(32)16-5-6-19(20(13-16)31(33)34)29-9-11-35-12-10-29/h5-6,13-15H,3-4,7-12H2,1-2H3 |
| InChIKey | DQRCNMZDTGTROW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|